Bulk Discount Available!
(±)-11-Hydroxy-Δ⁹-THC solution, 1 X 1 mL (H-026-1ML)
MilliporeSigma® (Sigma-Aldrich)
$91.65
Earn points on this purchase
| storage temp. | −20°C |
| SMILES string | OC1=CC(CCCCC)=CC2=C1C3C=C(CO)CCC3C(O2)(C)C |
| form | liquid |
| packaging | ampule of 1 mL |
| technique(s) | liquid chromatography (LC): suitable |
| InChI | 1S/C21H30O3/c1-4-5-6-7-14-11-18(23)20-16-10-15(13-22)8-9-17(16)21(2,3)24-19(20)12-14/h10-12,16-17,22-23H,4-9,13H2,1-3H3 |
| format | single component solution |
| grade | certified reference material |
| Quality Level | 300 |
| technique(s) | gas chromatography (GC): suitable |
| drug control | psicótropo (Spain); Decreto Lei 15/93: Tabela IIB (Portugal) |
| CAS_NO | 34675-49-5 |
| manufacturer/tradename | Cerilliant® |
| application(s) | cannabis testingforensics and toxicology |
| InChI key | YCBKSSAWEUDACY-UHFFFAOYSA-N |
| concentration | 100 μg/mL in methanol |
| feature | Snap-N-Spike®/Snap-N-Shoot® |