Bulk Discount Available!
Abacavir Related Compound A, 50 mg (PHR2064-50MG)
MilliporeSigma® (Sigma-Aldrich)
$931.76
Earn points on this purchase
| grade | certified reference material |
| CofA | current certificate can be downloaded |
| InChI | 1S/C11H14N6O/c12-9-8-10(16-11(13)15-9)17(5-14-8)7-2-1-6(3-7)4-18/h1-2,5-7,18H,3-4H2,(H4,12,13,15,16)/t6-,7+/m1/s1 |
| InChI key | ZKJUXHDSLJYKED-RQJHMYQMSA-N |
| CAS_NO | 124752-25-6 |
| format | neat |
| packaging | pkg of 50 mg |
| storage temp. | 2-8°C |
| Quality Level | 300 |
| agency | traceable to USP 1000420 |
| application(s) | pharmaceutical |
| SMILES string | [n]2(c3nc(nc(c3nc2)N)N)[C@@H]1C[C@@H](C=C1)CO |
| grade | pharmaceutical secondary standard |
| API family | abacavir, abacavir |