Bulk Discount Available!
Meglumine, 1 X 1 g (PHR1324-1G)
MilliporeSigma® (Sigma-Aldrich)
$109.98
Earn points on this purchase
| InChI | 1S/C7H17NO5/c1-8-2-4(10)6(12)7(13)5(11)3-9/h4-13H,2-3H2,1H3/t4-,5+,6+,7+/m0/s1 |
| agency | traceable to USP 1379140 |
| mp | 129-131.5 °C (lit.) |
| InChI key | MBBZMMPHUWSWHV-BDVNFPICSA-N |
| grade | pharmaceutical secondary standard |
| format | neat |
| SMILES string | CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| technique(s) | HPLC: suitable |
| API family | meglumine |
| Quality Level | 300 |
| agency | traceable to Ph. Eur. Y0001209 |
| CofA | current certificate can be downloaded |
| storage temp. | 2-30°C |
| CAS_NO | 6284-40-8 |
| grade | certified reference material |
| technique(s) | gas chromatography (GC): suitable |
| application(s) | pharmaceutical (small molecule) |
| autoignition temp. | ~662 °F |