Bulk Discount Available!
17α-Methyltestosterone, 50 mg (46444-50MG)
MilliporeSigma® (Sigma-Aldrich)
$121.98
Earn points on this purchase
| CAS_NO | 58-18-4 |
| technique(s) | gas chromatography (GC): suitable |
| grade | analytical standard |
| Gene Information | human ... AR(367) |
| SMILES string | C[C@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | 1S/C20H30O2/c1-18-9-6-14(21)12-13(18)4-5-15-16(18)7-10-19(2)17(15)8-11-20(19,3)22/h12,15-17,22H,4-11H2,1-3H3/t15-,16+,17+,18+,19+,20+/m1/s1 |
| drug control | USDEA Schedule IIIN; regulated under CDSA - not available from Sigma-Aldrich Canada |
| application(s) | forensics and toxicologypharmaceutical (small molecule) |
| shelf life | limited shelf life, expiry date on the label |
| technique(s) | HPLC: suitable |
| mp | 162-168 °C (lit.) |
| InChI key | GCKMFJBGXUYNAG-HLXURNFRSA-N |
| product line | VETRANAL® |
| format | neat |
