Bulk Discount Available!
4-Nitrobenzophenone oxime, polymer-bound, 1 X 5 g (477044-5G)
MilliporeSigma® (Sigma-Aldrich)
$266.00
Earn points on this purchase
| crosslinking | 1 % cross-linked with divinylbenzene |
| SMILES string | C=Cc1ccccc1.C=Cc2ccc(C=C)cc2.O\N=C(\c3ccccc3)c4ccc(cc4)[N+]([O-])=O |
| reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| particle size | 200-400 mesh |
| functional group | oxime |
| extent of labeling | 1.0-1.5 mmol/g loading |
| Quality Level | 100 |
| storage temp. | −20°C |
