Bulk Discount Available!
5-MeO-DiPT, 1 mL (M-167-1ML)
MilliporeSigma® (Sigma-Aldrich)
$278.29
Earn points on this purchase
| CAS_NO | 4021-34-5 |
| application(s) | forensics and toxicology |
| technique(s) | gas chromatography (GC): suitable |
| feature | Snap-N-Spike®/Snap-N-Shoot® |
| InChI key | DNBPMBJFRRVTSJ-UHFFFAOYSA-N |
| form | liquid |
| manufacturer/tradename | Cerilliant® |
| concentration | 1.0 mg/mL in methanol |
| technique(s) | liquid chromatography (LC): suitable |
| grade | certified reference material |
| storage temp. | −20°C |
| SMILES string | [nH]1c2c(c(c1)CCN(C(C)C)C(C)C)cc(cc2)OC |
| format | single component solution |
| packaging | ampule of 1 mL |
| InChI | 1S/C17H26N2O/c1-12(2)19(13(3)4)9-8-14-11-18-17-7-6-15(20-5)10-16(14)17/h6-7,10-13,18H,8-9H2,1-5H3 |
| Quality Level | 300 |