Bulk Discount Available!
5-MeO-DMT solution, 1 mL (M-168-1ML)
MilliporeSigma® (Sigma-Aldrich)
$221.29
Earn points on this purchase
| format | single component solution |
| CAS_NO | 1019-45-0 |
| InChI | 1S/C13H18N2O/c1-15(2)7-6-10-9-14-13-5-4-11(16-3)8-12(10)13/h4-5,8-9,14H,6-7H2,1-3H3 |
| technique(s) | liquid chromatography (LC): suitable |
| concentration | 1.0 mg/mL in methanol |
| SMILES string | CN(C)CCC1=CNC2=CC=C(OC)C=C21 |
| manufacturer/tradename | Cerilliant® |
| drug control | Narcotic Licence Schedule E (Switzerland) |
| feature | Snap-N-Spike®/Snap-N-Shoot® |
| storage temp. | −20°C |
| form | liquid |
| packaging | ampule of 1 mL |
| application(s) | forensics and toxicology |
| Quality Level | 300 |
| InChI key | ZSTKHSQDNIGFLM-UHFFFAOYSA-N |
| grade | certified reference material |
| technique(s) | gas chromatography (GC): suitable |
