Bulk Discount Available!
Aripiprazole, 500 mg (PHR1784-500MG)
MilliporeSigma® (Sigma-Aldrich)
$306.24
Earn points on this purchase
| CofA | current certificate can be downloaded |
| SMILES string | Clc1c(cccc1N2CCN(CC2)CCCCOc3cc4c(cc3)CCC(=O)N4)Cl |
| format | neat |
| technique(s) | gas chromatography (GC): suitable |
| InChI key | CEUORZQYGODEFX-UHFFFAOYSA-N |
| storage temp. | 2-30°C |
| grade | certified reference material |
| application(s) | pharmaceutical (small molecule) |
| CAS_NO | 129722-12-9 |
| API family | aripiprazole |
| grade | pharmaceutical secondary standard |
| agency | traceable to Ph. Eur. Y0001649 |
| agency | traceable to USP 1042634 |
| packaging | pkg of 500 mg |
| InChI | 1S/C23H27Cl2N3O2/c24-19-4-3-5-21(23(19)25)28-13-11-27(12-14-28)10-1-2-15-30-18-8-6-17-7-9-22(29)26-20(17)16-18/h3-6,8,16H,1-2,7,9-15H2,(H,26,29) |
| technique(s) | HPLC: suitable |
| Quality Level | 300 |