Bulk Discount Available!
Aripiprazole Related Compound G, 1 X 100 mg (PHR2323-100MG)
MilliporeSigma® (Sigma-Aldrich)
$699.11
Earn points on this purchase
| packaging | pkg of 100 mg |
| API family | aripiprazole |
| CAS_NO | 129722-25-4 |
| storage temp. | 2-8°C |
| application(s) | pharmaceutical small molecule |
| form | powder |
| agency | traceable to USP 1042690 |
| grade | pharmaceutical secondary standard |
| grade | certified reference material |
| InChI key | CDONPRYEWWPREK-UHFFFAOYSA-N |
| SMILES string | Clc1c(cccc1N2CCN(CC2)CCCCOc3cc4[nH][c](ccc4cc3)=O)Cl |
| CofA | current certificate can be downloaded |
| InChI | 1S/C23H25Cl2N3O2/c24-19-4-3-5-21(23(19)25)28-13-11-27(12-14-28)10-1-2-15-30-18-8-6-17-7-9-22(29)26-20(17)16-18/h3-9,16H,1-2,10-15H2,(H,26,29) |
| Quality Level | 300 |