Bulk Discount Available!
Avobenzone, 1 X 1 g (PHR1073-1G)
MilliporeSigma® (Sigma-Aldrich)
$108.31
Earn points on this purchase
| CAS_NO | 70356-09-1 |
| storage temp. | 2-30°C |
| grade | pharmaceutical secondary standard |
| CofA | current certificate can be downloaded |
| technique(s) | HPLC: suitable |
| InChI key | XNEFYCZVKIDDMS-UHFFFAOYSA-N |
| technique(s) | gas chromatography (GC): suitable |
| agency | traceable to USP 1045337 |
| Quality Level | 300 |
| grade | certified reference material |
| SMILES string | COc1ccc(cc1)C(=O)CC(=O)c2ccc(cc2)C(C)(C)C |
| API family | avobenzone |
| format | neat |
| InChI | 1S/C20H22O3/c1-20(2,3)16-9-5-14(6-10-16)18(21)13-19(22)15-7-11-17(23-4)12-8-15/h5-12H,13H2,1-4H3 |
| application(s) | environmentalpharmaceutical (small molecule) |