Bulk Discount Available!
Basic Fuchsin, 1 X 100 g (857343-100G)
MilliporeSigma® (Sigma-Aldrich)
$400.00
Earn points on this purchase
| ε (extinction coefficient) | ≥11000 at 235-239 nm in 50% ethanol at 0.003 g/L |
| InChI key | JUQPZRLQQYSMEQ-UHFFFAOYSA-N |
| CAS_NO | 569-61-9 |
| ε (extinction coefficient) | ≥17000 at 287-291 nm in 50% ethanol at 0.003 g/L |
| color | green to dark green |
| application(s) | diagnostic assay manufacturinghematologyhistology |
| form | powder |
| storage temp. | room temp |
| Quality Level | 200 |
| grade | certified by the Biological Stain Commission |
| mp | 268-270 °C (dec.) (lit.) |
| SMILES string | [Cl-].Nc1ccc(cc1)C(\c2ccc(N)cc2)=C3/C=CC(=[NH2+])C=C3 |
| InChI | 1S/C19H17N3.ClH/c20-16-7-1-13(2-8-16)19(14-3-9-17(21)10-4-14)15-5-11-18(22)12-6-15;/h1-12,20H,21-22H2;1H |
| composition | Dye content, ≥88% |
| technique(s) | microbe id | staining: suitable |
| λmax | 544 nm |
| pH | 1.0-3.1, purple to red |
