Bulk Discount Available!
Bathocuproinedisulfonic acid disodium salt, 1 X 5 g (B1125-5G)
MilliporeSigma® (Sigma-Aldrich)
$853.00
Earn points on this purchase
| InChI key | RNGKZLRAVYPLJC-UHFFFAOYSA-L |
| quality | for spectrophotometric det. of Cu, Fe |
| form | powder |
| storage temp. | room temp |
| technique(s) | titration: 90% using HCLO4 (Dry Basis) |
| suitability | suitable for determination of copper |
| assay | 7.2-9.1% dry basis (ICP) |
| InChI | 1S/C26H20N2O6S2.2Na/c1-15-25(35(29,30)31)21(17-9-5-3-6-10-17)19-13-14-20-22(18-11-7-4-8-12-18)26(36(32,33)34)16(2)28-24(20)23(19)27-15;;/h3-14H,1-2H3,(H,29,30,31)(H,32,33,34);;/q;2*+1/p-2 |
| solubility | H2O: 50 mg/mL |
| CAS_NO | 52698-84-7 |
| application(s) | diagnostic assay manufacturinghematologyhistology |
| Quality Level | 200 |
| SMILES string | [Na+].[Na+].[S](=O)(=O)([O-])c1c(nc2c3nc(c(c(c3ccc2c1c5ccccc5)c4ccccc4)[S](=O)(=O)[O-])C)C |
| color | white to beige |