Bulk Discount Available!
Bromhexine hydrochloride, 200 mg (PHR1831-200MG)
MilliporeSigma® (Sigma-Aldrich)
$194.47
Earn points on this purchase
| format | neat |
| technique(s) | gas chromatography (GC): suitable |
| SMILES string | Cl.CN(Cc1cc(Br)cc(Br)c1N)C2CCCCC2 |
| API family | bromhexine |
| CAS_NO | 611-75-6 |
| application(s) | pharmaceutical (small molecule) |
| grade | certified reference material |
| technique(s) | HPLC: suitable |
| grade | pharmaceutical secondary standard |
| InChI key | UCDKONUHZNTQPY-UHFFFAOYSA-N |
| packaging | pkg of 200 mg |
| agency | traceable to Ph. Eur. B1145000 |
| InChI | 1S/C14H20Br2N2.ClH/c1-18(12-5-3-2-4-6-12)9-10-7-11(15)8-13(16)14(10)17;/h7-8,12H,2-6,9,17H2,1H3;1H |
| Quality Level | 300 |
| CofA | current certificate can be downloaded |
| storage temp. | 2-8°C |