Bulk Discount Available!
Bromocresol Purple sodium salt, 1 X 25 g (860891-25G)
MilliporeSigma® (Sigma-Aldrich)
$115.00
Earn points on this purchase
| InChI key | WNOIORUCCYNQPE-UHFFFAOYSA-M |
| technique(s) | titration: suitable |
| application(s) | diagnostic assay manufacturinghematologyhistology |
| storage temp. | room temp |
| CAS_NO | 62625-30-3 |
| ε (extinction coefficient) | ≥7000 at 375-381 nm in 0.1 M NaOH |
| ε (extinction coefficient) | ≥47000 at 587-591 nm in 0.1 M NaOH |
| InChI | 1S/C21H16Br2O5S.Na/c1-11-7-13(9-16(22)19(11)24)21(14-8-12(2)20(25)17(23)10-14)15-5-3-4-6-18(15)29(26,27)28-21;/h3-10,24-25H,1-2H3;/q;+1/p-1 |
| λmax | 379 nm |
| λmax | 585 nm (2nd) |
| SMILES string | [Na+].Cc1cc(cc(Br)c1O)C2(OS(=O)(=O)c3ccccc23)c4cc(C)c([O-])c(Br)c4 |
| visual transition interval | 5.2-6.8, yellow to purple |
| mp | 255 °C (dec.) (lit.) |
| grade | indicator grade |
| Quality Level | 200 |
| color | brown to very dark brown, to Very Dark Red |
| composition | Dye content, 90% |
| form | powder |
