Bulk Discount Available!
Budesonide, 1 X 500 mg (PHR1178-500MG)
MilliporeSigma® (Sigma-Aldrich)
$145.29
Earn points on this purchase
| agency | traceable to BP 793 |
| API family | budesonide |
| SMILES string | [H][C@@]12CCC3=CC(=O)C=C[C@]3(C)[C@@]1([H])[C@@H](O)C[C@@]4(C)[C@@]2([H])C[C@H]5OC(CCC)O[C@@]45C(=O)CO |
| Quality Level | 300 |
| InChI | 1S/C25H34O6/c1-4-5-21-30-20-11-17-16-7-6-14-10-15(27)8-9-23(14,2)22(16)18(28)12-24(17,3)25(20,31-21)19(29)13-26/h8-10,16-18,20-22,26,28H,4-7,11-13H2,1-3H3/t16-,17-,18-,20+,21?,22+,23-,24-,25+/m0/s1 |
| technique(s) | gas chromatography (GC): suitable |
| Gene Information | human ... NR3C1(2908) |
| CofA | current certificate can be downloaded |
| format | neat |
| agency | traceable to Ph. Eur. B1157300 |
| grade | certified reference material |
| agency | traceable to USP 1078201 |
| application(s) | pharmaceutical (small molecule) |
| InChI key | VOVIALXJUBGFJZ-KWVAZRHASA-N |
| storage temp. | 2-8°C |
| technique(s) | HPLC: suitable |
| grade | pharmaceutical secondary standard |
| CAS_NO | 51333-22-3 |