Bulk Discount Available!
Buphedrone hydrochloride solution, 1 X 1 mL (B-047-1ML)
MilliporeSigma® (Sigma-Aldrich)
$366.59
Earn points on this purchase
| Quality Level | 300 |
| technique(s) | liquid chromatography (LC): suitable |
| manufacturer/tradename | Cerilliant® |
| packaging | ampule of 1 mL |
| application(s) | forensics and toxicology |
| grade | certified reference material |
| technique(s) | gas chromatography (GC): suitable |
| InChI key | WJQBARDMJLAIJX-UHFFFAOYSA-N |
| feature | SNAP-N-SPIKE®, SNAP-N-SHOOT® |
| InChI | 1S/C11H15NO.ClH/c1-3-10(12-2)11(13)9-7-5-4-6-8-9;/h4-8,10,12H,3H2,1-2H3;1H |
| storage temp. | −20°C |
| format | single component solution |
| form | liquid |
| SMILES string | Cl.N(C(CC)C(=O)c1ccccc1)C |
| drug control | Narcotic Licence Schedule E (Switzerland) |
| concentration | 1.0 mg/mL in methanol (as free base) |
| CAS_NO | 166593-10-8 |