Bulk Discount Available!
Butylone-d₃ hydrochloride solution, 1 X 1 mL (B-046-1ML)
MilliporeSigma® (Sigma-Aldrich)
$317.41
Earn points on this purchase
| packaging | ampule of 1 mL |
| format | single component solution |
| storage temp. | −20°C |
| technique(s) | liquid chromatography (LC): suitable |
| application(s) | forensics and toxicology |
| CAS_NO | 1231710-63-6 |
| manufacturer/tradename | Cerilliant® |
| form | liquid |
| InChI key | KCJFEZQEDOBEOT-MUTAZJQDSA-N |
| grade | certified reference material |
| concentration | 100 μg/mL in methanol (as free base) |
| drug control | Narcotic Licence Schedule D (Switzerland) |
| Quality Level | 300 |
| technique(s) | gas chromatography (GC): suitable |
| SMILES string | Cl.N(C(CC)C(=O)c1cc2c(cc1)OCO2)C([2H])([2H])[2H] |
| InChI | 1S/C12H15NO3.ClH/c1-3-9(13-2)12(14)8-4-5-10-11(6-8)16-7-15-10;/h4-6,9,13H,3,7H2,1-2H3;1H/i2D3; |
| feature | SNAP-N-SPIKE®, SNAP-N-SHOOT® |