Bulk Discount Available!
Candesartan Cilexetil Related Compound B, 20 mg (PHR2018-20MG)
MilliporeSigma® (Sigma-Aldrich)
$927.65
Earn points on this purchase
| agency | traceable to USP 1087825 |
| API family | candesartan |
| InChI | 1S/C31H30N6O6/c1-19(42-31(40)43-22-8-3-2-4-9-22)41-29(38)25-12-7-13-26-27(25)37(30(39)32-26)18-20-14-16-21(17-15-20)23-10-5-6-11-24(23)28-33-35-36-34-28/h5-7,10-17,19,22H,2-4,8-9,18H2,1H3,(H,32,39)(H,33,34,35,36) |
| grade | certified reference material |
| packaging | pkg of 20 mg |
| SMILES string | [nH]1nnc(n1)c2c(cccc2)c3ccc(cc3)C[n]4c5c(nc4O)cccc5C(=O)OC(OC(=O)OC6CCCCC6)C |
| CAS_NO | 869631-11-8 |
| format | neat |
| InChI key | UEJMFQHOVKQHHB-UHFFFAOYSA-N |
| grade | pharmaceutical secondary standard |
| application(s) | pharmaceutical |
| CofA | current certificate can be downloaded |
| Quality Level | 300 |
| storage temp. | 2-8°C |