Bulk Discount Available!
cataCXium® A Pd G3, 1 X 250 mg (761435-250MG)
MilliporeSigma® (Sigma-Aldrich)
$169.88
Earn points on this purchase
| assay | 95% |
| reaction suitability | reaction type: Hiyama Coupling |
| InChI key | REYVZCOGMIXVNX-DVBMAMJVSA-M |
| impurities | ≤3% acetone |
| reaction suitability | reaction type: Heck Reaction |
| greener alternative category | Re-engineered |
| form | solid |
| reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction |
| greener alternative product characteristics | Waste PreventionAtom EconomySafer Solvents and AuxiliariesLearn more about the Principles of Green Chemistry. |
| CAS_NO | 1651823-59-4 |
| reaction suitability | reaction type: Sonogashira Coupling |
| reaction suitability | reaction type: Stille Coupling |
| functional group | phosphine |
| sustainability | Greener Alternative Product |
| SMILES string | CS(=O)(=O)O[Pd]c1ccccc1-c2ccccc2N.CCCCP([C@@]34C[C@@H]5C[C@@H](C[C@@H](C5)C3)C4)[C@@]67C[C@@H]8C[C@@H](C[C@@H](C8)C6)C7 |
| Quality Level | 100 |
| InChI | 1S/C24H39P.C12H10N.CH4O3S.Pd/c1-2-3-4-25(23-11-17-5-18(12-23)7-19(6-17)13-23)24-14-20-8-21(15-24)10-22(9-20)16-24;13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;1-5(2,3)4;/h17-22H,2-16H2,1H3;1-6,8-9H,13H2;1H3,(H,2,3,4);/q;;;+1/p-1/t17-,18+,19-,20-,21+,22-,23-,24-;;; |
| greener alternative product score | old score: 16new score: 2Find out more about DOZNâ„¢ Scoring |
| mp | 196-241 °C (decomposition) |
| reaction suitability | reagent type: catalystreaction type: Cross Couplings |
| reaction suitability | reaction type: Negishi Coupling |
| reaction suitability | reaction type: Suzuki-Miyaura Coupling |
| feature | generation 3 |
