Bulk Discount Available!
Cetirizine hydrochloride Related Compound A, 40 mg (PHR1710-40MG)
MilliporeSigma® (Sigma-Aldrich)
$810.29
Earn points on this purchase
| technique(s) | HPLC: suitable |
| agency | traceable to USP 1102930 |
| API family | cetirizine |
| packaging | pkg of 40 mg |
| CAS_NO | 246870-46-2 |
| grade | certified reference material |
| storage temp. | -10 to -25°C |
| application(s) | pharmaceutical (small molecule) |
| InChI key | ASHQTVRYHSZGQY-UHFFFAOYSA-N |
| Quality Level | 300 |
| grade | pharmaceutical secondary standard |
| format | neat |
| InChI | 1S/C23H29ClN2O3/c1-2-29-22(27)18-28-17-16-25-12-14-26(15-13-25)23(19-6-4-3-5-7-19)20-8-10-21(24)11-9-20/h3-11,23H,2,12-18H2,1H3 |
| CofA | current certificate can be downloaded |
| SMILES string | Clc1ccc(cc1)C(N3CCN(CC3)CCOCC(=O)OCC)c2ccccc2 |
| technique(s) | gas chromatography (GC): suitable |