Bulk Discount Available!
Chlorobutanol, 1 g (PHR1545-1G)
MilliporeSigma® (Sigma-Aldrich)
$120.71
Earn points on this purchase
| technique(s) | gas chromatography (GC): suitable |
| application(s) | pharmaceutical (small molecule) |
| API family | chlorobutanol |
| InChI key | WRWLCXJYIMRJIN-UHFFFAOYSA-N |
| InChI | 1S/2C4H7Cl3O.H2O/c2*1-3(2,8)4(5,6)7;/h2*8H,1-2H3;1H2 |
| Quality Level | 300 |
| grade | pharmaceutical secondary standard |
| SMILES string | O.CC(C)(O)C(Cl)(Cl)Cl.CC(C)(O)C(Cl)(Cl)Cl |
| CofA | current certificate can be downloaded |
| grade | certified reference material |
| format | neat |
| packaging | pkg of 1 g |
| technique(s) | HPLC: suitable |
| CAS_NO | 6001-64-5 |
| storage temp. | 2-30°C |
| agency | traceable to USP 1112503 |