Bulk Discount Available!
Chlorothiazide, 1 X 500 mg (PHR1179-500MG)
MilliporeSigma® (Sigma-Aldrich)
$111.76
Earn points on this purchase
| storage temp. | 2-8°C |
| InChI | 1S/C7H6ClN3O4S2/c8-4-1-5-7(2-6(4)16(9,12)13)17(14,15)11-3-10-5/h1-3H,(H,10,11)(H2,9,12,13) |
| Quality Level | 300 |
| CAS_NO | 58-94-6 |
| agency | traceable to Ph. Eur. C1700000 |
| agency | traceable to BP 76 |
| API family | chlorothiazide |
| SMILES string | O=S(C1=C2C=C(Cl)C(S(N)(=O)=O)=C1)(NC=N2)=O |
| grade | pharmaceutical secondary standard |
| application(s) | pharmaceutical (small molecule) |
| format | neat |
| technique(s) | gas chromatography (GC): suitable |
| InChI key | JBMKAUGHUNFTOL-UHFFFAOYSA-N |
| Gene Information | human ... SLC12A3(6559) |
| technique(s) | HPLC: suitable |
| agency | traceable to USP 1121005 |
| CofA | current certificate can be downloaded |
| grade | certified reference material |