Bulk Discount Available!
Cocaine-D₃ solution, 1 X 1 mL (C-004-1ML)
MilliporeSigma® (Sigma-Aldrich)
$42.02
Earn points on this purchase
| drug control | Narcotic Licence Schedule A (Switzerland); estupefaciente (Spain); Decreto Lei 15/93: Tabela IB (Portugal) |
| application(s) | forensics and toxicology |
| InChI | 1S/C17H21NO4/c1-18-12-8-9-13(18)15(17(20)21-2)14(10-12)22-16(19)11-6-4-3-5-7-11/h3-7,12-15H,8-10H2,1-2H3/i1D3 |
| grade | certified reference material |
| manufacturer/tradename | Cerilliant® |
| InChI key | ZPUCINDJVBIVPJ-FIBGUPNXSA-N |
| concentration | 100 μg/mL in acetonitrile |
| storage temp. | −20°C |
| Quality Level | 300 |
| format | single component solution |
| SMILES string | N1(C2C(C(CC1CC2)OC(=O)c3ccccc3)C(=O)OC)C([2H])([2H])[2H] |
| CAS_NO | 138704-14-0 |
| technique(s) | liquid chromatography (LC): suitable |
| form | liquid |
| feature | SNAP-N-SPIKE®, SNAP-N-SHOOT® |
| technique(s) | gas chromatography (GC): suitable |
| packaging | ampule of 1 mL |