Bulk Discount Available!
Curcumin, 50 mg (PHR2209-50MG)
MilliporeSigma® (Sigma-Aldrich)
$185.53
Earn points on this purchase
| form | solid |
| grade | pharmaceutical secondary standard |
| CAS_NO | 458-37-7 |
| InChI key | VFLDPWHFBUODDF-FCXRPNKRSA-N |
| packaging | pkg of 50 mg |
| application(s) | pharmaceutical small molecule |
| storage temp. | -10 to -25°C |
| API family | curcumin |
| CofA | current certificate can be downloaded |
| grade | certified reference material |
| Quality Level | 300 |
| agency | traceable to USP 1151855 |
| vapor density | 13 (vs air) |
| SMILES string | COc1cc(\C=C\C(=O)CC(=O)\C=C\c2ccc(O)c(OC)c2)ccc1O |
| InChI | 1S/C21H20O6/c1-26-20-11-14(5-9-18(20)24)3-7-16(22)13-17(23)8-4-15-6-10-19(25)21(12-15)27-2/h3-12,24-25H,13H2,1-2H3/b7-3+,8-4+ |