Bulk Discount Available!
D4 Cyclomethicone, 500 mg (PHR1565-500MG)
MilliporeSigma® (Sigma-Aldrich)
$120.71
Earn points on this purchase
| CAS_NO | 556-67-2 |
| SMILES string | C[Si]1(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O1 |
| technique(s) | gas chromatography (GC): suitable |
| API family | cyclomethicone |
| packaging | pkg of 500 mg |
| density | 0.956 g/mL at 25 °C (lit.) |
| bp | 175-176 °C (lit.) |
| InChI key | HMMGMWAXVFQUOA-UHFFFAOYSA-N |
| vapor density | 1 (vs air) |
| Quality Level | 300 |
| technique(s) | HPLC: suitable |
| grade | certified reference material |
| format | neat |
| grade | pharmaceutical secondary standard |
| refractive index | n20/D 1.396 (lit.) |
| application(s) | pharmaceutical (small molecule) |
| CofA | current certificate can be downloaded |
| agency | traceable to USP 1154707 |
| storage temp. | 2-30°C |
| mp | 17-18 °C (lit.) |
| InChI | 1S/C8H24O4Si4/c1-13(2)9-14(3,4)11-16(7,8)12-15(5,6)10-13/h1-8H3 |
| form | liquid |