Bulk Discount Available!
Desbenzyl donepezil hydrochloride, 50 mg (PHR2025-50MG)
MilliporeSigma® (Sigma-Aldrich)
$743.24
Earn points on this purchase
| application(s) | pharmaceutical |
| InChI key | WOZXDQQCMZIQEG-UHFFFAOYSA-N |
| grade | certified reference material |
| storage temp. | 2-8°C |
| format | neat |
| Quality Level | 300 |
| CAS_NO | 120013-39-0 |
| agency | traceable to USP 1171819 |
| SMILES string | Cl.N1CCC(CC1)CC2Cc3c(cc(c(c3)OC)OC)C2=O |
| packaging | pkg of 50 mg |
| API family | donepezil |
| InChI | 1S/C17H23NO3.ClH/c1-20-15-9-12-8-13(7-11-3-5-18-6-4-11)17(19)14(12)10-16(15)21-2;/h9-11,13,18H,3-8H2,1-2H3;1H |
| CofA | current certificate can be downloaded |
| grade | pharmaceutical secondary standard |