Bulk Discount Available!
Desonide, 1 X 300 mg (PHR2574-300MG)
MilliporeSigma® (Sigma-Aldrich)
$464.19
Earn points on this purchase
| storage temp. | 2-30°C |
| agency | traceable to USP 1173304 |
| packaging | pkg of 300 mg |
| grade | certified reference material |
| InChI key | WBGKWQHBNHJJPZ-YWZQBGSISA-N |
| application(s) | pharmaceutical small molecule |
| InChI | 1S/C24H32O6/c1-21(2)29-19-10-16-15-6-5-13-9-14(26)7-8-22(13,3)20(15)17(27)11-23(16,4)24(19,30-21)18(28)12-25/h7-9,15-17,19-20,25,27H,5-6,10-12H2,1-4H3/t15?,16-,17?,19+,20+,22?,23?,24+/m0/s1 |
| Quality Level | 300 |
| grade | pharmaceutical secondary standard |
| form | solid |
| API family | desonide |
| SMILES string | O1[C@@]2([C@H](OC1(C)C)C[C@@H]3C2(CC([C@H]4C3CCC5=CC(=O)C=CC54C)O)C)C(=O)CO |
| CofA | current certificate can be downloaded |
| CAS_NO | 638-94-8 |