Bulk Discount Available!
Dihydroethidium, 1 X 10 mg (D7008-10MG)
MilliporeSigma® (Sigma-Aldrich)
$216.00
Earn points on this purchase
| assay | ≥95% |
| InChI key | XYJODUBPWNZLML-UHFFFAOYSA-N |
| fluorescence | λex 370 nm; λem 420 nm (for cytoplasm of living cells) |
| fluorescence | λex 535 nm; λem 610 nm (for chromatin of living cells) |
| CAS_NO | 104821-25-2 |
| application(s) | diagnostic assay manufacturinghematologyhistology |
| color | pink to very dark red |
| SMILES string | CCN1C(c2ccccc2)c3cc(N)ccc3-c4ccc(N)cc14 |
| Quality Level | 100 |
| form | powder |
| technique(s) | titration: suitable |
| storage temp. | −20°C |
| solubility | chloroform: 20 mg/mL |
| InChI | 1S/C21H21N3/c1-2-24-20-13-16(23)9-11-18(20)17-10-8-15(22)12-19(17)21(24)14-6-4-3-5-7-14/h3-13,21H,2,22-23H2,1H3 |