Bulk Discount Available!
Dimethyl isosorbide, 2.5 L (906832-2.5L)
MilliporeSigma® (Sigma-Aldrich)
$399.00
Earn points on this purchase
| assay | ≥99% |
| form | liquid |
| Quality Level | 100 |
| greener alternative category | Aligned, |
| InChI key | MEJYDZQQVZJMPP-ULAWRXDQSA-N |
| density | 1.15 g/mL at 25 °C (lit.) |
| product line | ReagentPlus® |
| bp | 93-95 °C/0.1 mmHg (lit.) |
| InChI | 1S/C8H14O4/c1-9-5-3-11-8-6(10-2)4-12-7(5)8/h5-8H,3-4H2,1-2H3/t5-,6+,7-,8-/m1/s1 |
| CAS_NO | 5306-85-4 |
| SMILES string | CO[C@H]1COC2[C@@H](COC12)OC |
| greener alternative product characteristics | Safer Solvents and AuxiliariesUse of Renewable FeedstocksLearn more about the Principles of Green Chemistry. |
| sustainability | Greener Alternative Product |
| refractive index | n20/D 1.461 (lit.) |