Bulk Discount Available!
Docosahexaenoic Acid Ethyl Ester, 1 g (PHR1788-1G)
MilliporeSigma® (Sigma-Aldrich)
$205.65
Earn points on this purchase
| Quality Level | 300 |
| InChI key | ITNKVODZACVXDS-YATCGRJWSA-N |
| storage temp. | -10 to -25°C |
| format | neat |
| application(s) | pharmaceutical (small molecule) |
| grade | certified reference material |
| technique(s) | gas chromatography (GC): suitable |
| agency | traceable to USP 1224620 |
| agency | traceable to Ph. Eur. D2954600 |
| technique(s) | HPLC: suitable |
| SMILES string | O(CC)C(=O)CC\C=C\C\C=C\C\C=C\C\C=C\C\C=C\C\C=C\CC |
| API family | docosahexaenoic acid ethyl ester |
| CAS_NO | 81926-94-5 |
| InChI | 1S/C24H36O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24(25)26-4-2/h5-6,8-9,11-12,14-15,17-18,20-21H,3-4,7,10,13,16,19,22-23H2,1-2H3/b6-5+,9-8+,12-11+,15-14+,18-17+,21-20+ |
| grade | pharmaceutical secondary standard |
| packaging | pkg of 1 g |
| CofA | current certificate can be downloaded |