Bulk Discount Available!
Ecgonine methyl ester solution, 1 X 1 mL (E-001-1ML)
MilliporeSigma® (Sigma-Aldrich)
$37.55
Earn points on this purchase
| SMILES string | N1(C2[C@H]([C@H](CC1CC2)O)C(=O)OC)C |
| CAS_NO | 9/1/7143 |
| manufacturer/tradename | Cerilliant® |
| drug control | Narcotic Licence Schedule A (Switzerland); estupefaciente (Spain); Decreto Lei 15/93: Tabela IB (Portugal) |
| format | single component solution |
| technique(s) | gas chromatography (GC): suitable |
| grade | certified reference material |
| feature | Snap-N-Spike®/Snap-N-Shoot® |
| storage temp. | −20°C |
| application(s) | forensics and toxicology |
| technique(s) | liquid chromatography (LC): suitable |
| concentration | 1.0 mg/mL in acetonitrile |
| form | liquid |
| Quality Level | 300 |
| InChI | 1S/C10H17NO3/c1-11-6-3-4-7(11)9(8(12)5-6)10(13)14-2/h6-9,12H,3-5H2,1-2H3/t6?,7?,8-,9+/m0/s1 |
| InChI key | QIQNNBXHAYSQRY-ABIFROTESA-N |
| packaging | ampule of 1 mL |