Bulk Discount Available!
Enrofloxacin, 500 mg (PHR1513-500MG)
MilliporeSigma® (Sigma-Aldrich)
$130.76
Earn points on this purchase
| SMILES string | CCN1CCN(CC1)c2cc3N(C=C(C(O)=O)C(=O)c3cc2F)C4CC4 |
| InChI key | SPFYMRJSYKOXGV-UHFFFAOYSA-N |
| agency | traceable to Ph. Eur. Y0001259 |
| CofA | current certificate can be downloaded |
| storage temp. | 2-8°C |
| grade | certified reference material |
| packaging | pkg of 500 mg |
| agency | traceable to USP 1235900 |
| application(s) | pharmaceutical (small molecule) |
| technique(s) | HPLC: suitable |
| technique(s) | gas chromatography (GC): suitable |
| format | neat |
| InChI | 1S/C19H22FN3O3/c1-2-21-5-7-22(8-6-21)17-10-16-13(9-15(17)20)18(24)14(19(25)26)11-23(16)12-3-4-12/h9-12H,2-8H2,1H3,(H,25,26) |
| Quality Level | 300 |
| CAS_NO | 93106-60-6 |
| API family | enrofloxacin |
| grade | pharmaceutical secondary standard |