Bulk Discount Available!
Ergosterol, 200 mg (PHR1512-200MG)
MilliporeSigma® (Sigma-Aldrich)
$130.76
Earn points on this purchase
| storage temp. | 2-8°C |
| grade | certified reference material |
| InChI | 1S/C28H44O/c1-18(2)19(3)7-8-20(4)24-11-12-25-23-10-9-21-17-22(29)13-15-27(21,5)26(23)14-16-28(24,25)6/h7-10,18-20,22,24-26,29H,11-17H2,1-6H3/b8-7+/t19-,20+,22-,24+,25-,26-,27-,28+/m0/s1 |
| agency | traceable to USP 1241007 |
| Quality Level | 300 |
| technique(s) | gas chromatography (GC): suitable |
| CAS_NO | 57-87-4 |
| InChI key | DNVPQKQSNYMLRS-APGDWVJJSA-N |
| grade | pharmaceutical secondary standard |
| technique(s) | HPLC: suitable |
| SMILES string | [H][C@@]1(CC[C@@]2([H])C3=CC=C4C[C@@H](O)CC[C@]4(C)[C@@]3([H])CC[C@]12C)[C@H](C)\C=C\[C@H](C)C(C)C |
| mp | 156-158 °C (lit.) |
| format | neat |
| application(s) | pharmaceutical (small molecule) |
| API family | ergosterol |
| agency | traceable to Ph. Eur. E1100000 |
| CofA | current certificate can be downloaded |
| form | solid |