Bulk Discount Available!
Ethyl-β-ᴅ-glucuronide, 1 X 1 mL (E-015-1ML)
MilliporeSigma® (Sigma-Aldrich)
$305.12
Earn points on this purchase
| CAS_NO | 17685-04-0 |
| form | liquid |
| InChI | 1S/C8H14O7/c1-2-14-8-5(11)3(9)4(10)6(15-8)7(12)13/h3-6,8-11H,2H2,1H3,(H,12,13)/t3-,4-,5+,6-,8+/m0/s1 |
| concentration | 1.0 mg/mL in methanol |
| Quality Level | 300 |
| technique(s) | liquid chromatography (LC): suitable |
| format | single component solution |
| technique(s) | gas chromatography (GC): suitable |
| storage temp. | −20°C |
| application(s) | forensics and toxicology |
| SMILES string | O[C@H]1[C@H](O)[C@@H](C(O)=O)O[C@@H](OCC)[C@@H]1O |
| feature | Snap-N-Spike®/Snap-N-Shoot® |
| InChI key | IWJBVMJWSPZNJH-UQGZVRACSA-N |
| manufacturer/tradename | Cerilliant® |
| grade | certified reference material |
| packaging | ampule of 1 mL |