Bulk Discount Available!
Famciclovir, 1 g (PHR1696-1G)
MilliporeSigma® (Sigma-Aldrich)
$287.24
Earn points on this purchase
| application(s) | pharmaceutical (small molecule) |
| API family | famciclovir |
| InChI | 1S/C14H19N5O4/c1-9(20)22-6-11(7-23-10(2)21)3-4-19-8-17-12-5-16-14(15)18-13(12)19/h5,8,11H,3-4,6-7H2,1-2H3,(H2,15,16,18) |
| technique(s) | gas chromatography (GC): suitable |
| packaging | pkg of 1 g |
| grade | certified reference material |
| Quality Level | 300 |
| format | neat |
| storage temp. | 2-8°C |
| grade | pharmaceutical secondary standard |
| CAS_NO | 104227-87-4 |
| SMILES string | CC(=O)OCC(CCn1cnc2cnc(N)nc12)COC(C)=O |
| InChI key | GGXKWVWZWMLJEH-UHFFFAOYSA-N |
| technique(s) | HPLC: suitable |
| agency | traceable to USP 1269152 |
| CofA | current certificate can be downloaded |