Bulk Discount Available!
Fmoc-Phe-Wang resin, 1 X 5 g (47666-5G-F)
MilliporeSigma® (Sigma-Aldrich)
$305.12
Earn points on this purchase
| extent of labeling | 0.4-0.8 mmol/g loading |
| reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| particle size | 100-200 mesh |
| matrix | polystyrene, crosslinked with 1% DVB |
| application(s) | peptide synthesis |
| storage temp. | 2-8°C |
| Quality Level | 100 |
| SMILES string | [X]C(=O)[C@@H](NC(=O)OCC2c3c(cccc3)c4c2cccc4)Cc1ccccc1 |
| functional group | Fmoc |
