Bulk Discount Available!
Glimepiride Related Compound C, 40 mg (PHR1727-40MG)
MilliporeSigma® (Sigma-Aldrich)
$785.71
Earn points on this purchase
| grade | pharmaceutical secondary standard |
| InChI | 1S/C18H23N3O6S/c1-4-15-12(2)11-21(16(15)22)17(23)19-10-9-13-5-7-14(8-6-13)28(25,26)20-18(24)27-3/h5-8H,4,9-11H2,1-3H3,(H,19,23)(H,20,24) |
| InChI key | UZDRZEOOIXNUTE-UHFFFAOYSA-N |
| SMILES string | [S](=O)(=O)(NC(=O)OC)c1ccc(cc1)CCNC(=O)N2CC(=C(C2=O)CC)C |
| form | solid |
| grade | certified reference material |
| API family | glimepiride |
| agency | traceable to USP 1292336 |
| CofA | current certificate can be downloaded |
| CAS_NO | 119018-30-3 |
| Quality Level | 300 |
| technique(s) | HPLC: suitable |
| storage temp. | 2-8°C |
| technique(s) | gas chromatography (GC): suitable |
| packaging | pkg of 40 mg |
| application(s) | pharmaceutical (small molecule) |