Bulk Discount Available!
Gram’s safranin solution, 1 X 250 mL (94635-250ML-F)
MilliporeSigma® (Sigma-Aldrich)
$60.99
Earn points on this purchase
| antibiotic activity spectrum | Gram-positive bacteria |
| InChI | 1S/C20H18N4.ClH/c1-12-8-17-19(10-15(12)21)24(14-6-4-3-5-7-14)20-11-16(22)13(2)9-18(20)23-17;/h3-11H,1-2H3,(H3,21,22);1H |
| Quality Level | 100 |
| color | red to very dark red |
| εmax | 4.0 at 532 nm in 50% ethanol |
| storage temp. | room temp |
| shelf life | limited shelf life, expiry date on the label |
| composition | ethanol, 10% |
| SMILES string | [Cl-].Cc1cc2nc3cc(C)c(N)cc3[n+](-c4ccccc4)c2cc1N |
| density | 0.986 g/mL at 20 °C |
| CAS_NO | 477-73-6 |
| antibiotic activity spectrum | Gram-negative bacteria |
| refractive index | n20/D 1.339 |
| application(s) | diagnostic assay manufacturinghematologyhistology |
| solubility | water: soluble at 20 °C |
| form | liquid |
| InChI key | OARRHUQTFTUEOS-UHFFFAOYSA-N |
| grade | for microscopy |
| technique(s) | microbe id | staining: suitable |