Bulk Discount Available!
Heparin sodium salt from porcine intestinal mucosa, 1 X 1000000 units (H3393-1MU)
MilliporeSigma® (Sigma-Aldrich)
$661.00
Earn points on this purchase
| biological source | Porcine intestinal mucosa |
| type | Grade I-A |
| CAS_NO | 8/1/9041 |
| storage temp. | room temp |
| InChI key | JRTRSJGZMRQDHI-UHFFFAOYSA-N |
| solubility | H2O: 50 mg/mL, clear, colorless to faintly yellow |
| specific activity | ≥180 USP units/mg |
| form | powder |
| SMILES string | [Na+].[S](=O)(=O)(NC1C(OC(C(C1O[S](=O)(=O)O)OC4OC(C(C(C4O[S](=O)(=O)O)O)O)C(=O)O)CO)OC2C(OC(C(C2O)O[S](=O)(=O)O)OC3C(OC(C(C3O)NC(=O)C)O)CO[S](=O)(=O)O)C(=O)O)O |
| application(s) | clinical researchdiagnostic assay manufacturinglife science and biopharma |
| color | beige |
| Quality Level | 200 |
| useful pH range | 5.0 - 7.5 |