Bulk Discount Available!
HEPES, Free Acid, Molecular Biology Grade, 250 g (391340-250GM)
MilliporeSigma® (Sigma-Aldrich)
$432.11
Earn points on this purchase
| storage condition | OK to freeze |
| InChI key | JKMHFZQWWAIEOD-UHFFFAOYSA-N |
| CAS_NO | 7365-45-9 |
| shipped in | ambient |
| manufacturer/tradename | Calbiochem® |
| cation traces | heavy metals: ≤0.0005% |
| solubility | water: 400 mg/mL |
| color | white |
| SMILES string | OCCN1CCN(CC1)CCS(O)(=O)=O |
| foreign activity | DNase, RNase, and protease, none detected |
| assay | ≥99% (alkalimetric) |
| Quality Level | 100 |
| grade | Molecular Biology |
| solubility | aqueous base: soluble |
| pKa (25 °C) | 7.5 |
| form | solid |
| useful pH range | 6.8-8.2 |
| InChI | 1S/C8H18N2O4S/c11-7-5-9-1-3-10(4-2-9)6-8-15(12,13)14/h11H,1-8H2,(H,12,13,14) |
| storage temp. | 15-25°C |