Bulk Discount Available!
Ibuprofen Methyl Ester, 1 X 1 mL (PHR2137-1ML)
MilliporeSigma® (Sigma-Aldrich)
$280.09
Earn points on this purchase
| grade | pharmaceutical secondary standard |
| InChI | 1S/C14H20O2/c1-10(2)9-12-5-7-13(8-6-12)11(3)14(15)16-4/h5-8,10-11H,9H2,1-4H3 |
| application(s) | pharmaceutical small molecule |
| CofA | current certificate can be downloaded |
| packaging | pkg of 1 mL |
| SMILES string | O(C)C(=O)C(C)c1ccc(cc1)CC(C)C |
| InChI key | YNZYUHPFNYBBFF-UHFFFAOYSA-N |
| API family | ibuprofen |
| CAS_NO | 61566-34-5 |
| form | liquid |
| storage temp. | 2-30°C |
| Quality Level | 300 |
| grade | certified reference material |