Bulk Discount Available!
Indomethacin, 1 X 500 mg (PHR1247-500MG)
MilliporeSigma® (Sigma-Aldrich)
$134.12
Earn points on this purchase
| CAS_NO | 53-86-1 |
| API family | indomethacin |
| grade | pharmaceutical secondary standard |
| agency | traceable to USP 1341001 |
| InChI key | CGIGDMFJXJATDK-UHFFFAOYSA-N |
| InChI | 1S/C19H16ClNO4/c1-11-15(10-18(22)23)16-9-14(25-2)7-8-17(16)21(11)19(24)12-3-5-13(20)6-4-12/h3-9H,10H2,1-2H3,(H,22,23) |
| SMILES string | COc1ccc2n(c(C)c(CC(O)=O)c2c1)C(=O)c3ccc(Cl)cc3 |
| Gene Information | human ... PTGS1(5742), PTGS2(5743) |
| technique(s) | gas chromatography (GC): suitable |
| Quality Level | 300 |
| application(s) | pharmaceutical (small molecule) |
| format | neat |
| storage temp. | 2-30°C |
| technique(s) | HPLC: suitable |
| grade | certified reference material |
| agency | traceable to Ph. Eur. I0200000 |
| CofA | current certificate can be downloaded |