Bulk Discount Available!
Itraconazole solution, 1 X 1 mL (I-015-1ML)
MilliporeSigma® (Sigma-Aldrich)
$108.86
Earn points on this purchase
| SMILES string | Clc1c(ccc(c1)Cl)[C@@]3(O[C@H](CO3)COc4ccc(cc4)N5CCN(CC5)c6ccc(cc6)[n]7[c]([n](nc7)C(CC)C)=O)C[n]2ncnc2 |
| Quality Level | 300 |
| application(s) | clinical testing |
| feature | (Snap-N-Spike®) |
| manufacturer/tradename | Cerilliant® |
| CAS_NO | 84625-61-6 |
| packaging | ampule of 1 mL |
| format | single component solution |
| technique(s) | gas chromatography (GC): suitable |
| InChI | 1S/C35H38Cl2N8O4/c1-3-25(2)45-34(46)44(24-40-45)29-7-5-27(6-8-29)41-14-16-42(17-15-41)28-9-11-30(12-10-28)47-19-31-20-48-35(49-31,21-43-23-38-22-39-43)32-13-4-26(36)18-33(32)37/h4-13,18,22-25,31H,3,14-17,19-21H2,1-2H3/t25?,31-,35-/m0/s1 |
| grade | certified reference material |
| form | liquid |
| concentration | 2.0 mg/mL (Methanol with 1% 1M HCl) |
| storage temp. | −20°C |
| InChI key | VHVPQPYKVGDNFY-ZPGVKDDISA-N |
| technique(s) | liquid chromatography (LC): suitable |