Bulk Discount Available!
Kanamycin sulfate from Streptomyces kanamyceticus, 1 X 5 g (K1377-5G)
MilliporeSigma® (Sigma-Aldrich)
$110.12
Earn points on this purchase
| antibiotic activity spectrum | Gram-positive bacteria |
| antibiotic activity spectrum | mycobacteria |
| solubility | H2O: 10-50 mg/mL (As a stock solution. Stock solutions should be stored at 2-8°C. Stable at 37°C for 5 days.) |
| technique(s) | cell culture | plant: suitable |
| antibiotic activity spectrum | Gram-negative bacteria |
| Quality Level | 200 |
| color | white to off-white |
| InChI | 1S/C18H36N4O11.H2O4S/c19-2-6-10(25)12(27)13(28)18(30-6)33-16-5(21)1-4(20)15(14(16)29)32-17-11(26)8(22)9(24)7(3-23)31-17;1-5(2,3)4/h4-18,23-29H,1-3,19-22H2;(H2,1,2,3,4)/t4-,5+,6-,7-,8+,9-,10-,11-,12+,13-,14-,15+,16-,17-,18-;/m1./s1 |
| application(s) | agriculture |
| mode of action | protein synthesis | interferes |
| CAS_NO | 25389-94-0 |
| technique(s) | cell culture | mammalian: suitable |
| product line | BioReagent |
| form | powder |
| potency | ≥750 μg per mg (dry basis) |
| SMILES string | OS(O)(=O)=O.NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O |
| biological source | Streptomyces kanamyceticus |
| InChI key | OOYGSFOGFJDDHP-KMCOLRRFSA-N |
| antibiotic activity spectrum | mycoplasma |