Bulk Discount Available!
Ketamine-D₄ hydrochloride solution, 1 mL (K-006-1ML)
MilliporeSigma® (Sigma-Aldrich)
$373.29
Earn points on this purchase
| storage temp. | −20°C |
| InChI key | VCMGMSHEPQENPE-SJSMECCZSA-N |
| SMILES string | ClC1=C([2H])C([2H])=C([2H])C([2H])=C1C2(NC)CCCCC2=O.Cl |
| format | single component solution |
| Quality Level | 300 |
| manufacturer/tradename | Cerilliant® |
| concentration | 1.0 mg/mL in methanol (as free base) |
| CAS_NO | 1246815-97-3 |
| application(s) | forensics and toxicology |
| grade | certified reference material |
| InChI | 1S/C13H16ClNO.ClH/c1-15-13(9-5-4-8-12(13)16)10-6-2-3-7-11(10)14;/h2-3,6-7,15H,4-5,8-9H2,1H3;1H/i2D,3D,6D,7D; |
| technique(s) | gas chromatography (GC): suitable |
| feature | Snap-N-Spike®/Snap-N-Shoot® |
| drug control | psicótropo (Spain) |
| form | liquid |
| packaging | ampule of 1 mL |
| technique(s) | liquid chromatography (LC): suitable |