Bulk Discount Available!
L-Cystine, 1 X 500 mg (PHR1323-500MG)
MilliporeSigma® (Sigma-Aldrich)
$111.76
Earn points on this purchase
| application(s) | pharmaceutical (small molecule) |
| mp | >240 °C (dec.) (lit.) |
| CAS_NO | 56-89-3 |
| grade | pharmaceutical secondary standard |
| InChI | 1S/C6H12N2O4S2/c7-3(5(9)10)1-13-14-2-4(8)6(11)12/h3-4H,1-2,7-8H2,(H,9,10)(H,11,12)/t3-,4-/m0/s1 |
| SMILES string | N[C@@H](CSSC[C@H](N)C(O)=O)C(O)=O |
| CofA | current certificate can be downloaded |
| technique(s) | HPLC: suitable |
| storage temp. | 2-30°C |
| technique(s) | gas chromatography (GC): suitable |
| agency | traceable to Ph. Eur. C3300000 |
| format | neat |
| agency | traceable to USP 1161586 |
| API family | cystine |
| InChI key | LEVWYRKDKASIDU-IMJSIDKUSA-N |
| Quality Level | 300 |
| grade | certified reference material |