Bulk Discount Available!
Levofloxacin Hemihydrate, 1 g (PHR1697-1G)
MilliporeSigma® (Sigma-Aldrich)
$198.94
Earn points on this purchase
| agency | traceable to USP 1362103 |
| CofA | current certificate can be downloaded |
| packaging | pkg of 1 g |
| grade | pharmaceutical secondary standard |
| API family | levofloxacin |
| technique(s) | gas chromatography (GC): suitable |
| storage temp. | 2-30°C |
| SMILES string | O.C[C@H]1COc2c(N3CCN(C)CC3)c(F)cc4C(=O)C(=CN1c24)C(O)=O.C[C@H]5COc6c(N7CCN(C)CC7)c(F)cc8C(=O)C(=CN5c68)C(O)=O |
| grade | certified reference material |
| application(s) | pharmaceutical (small molecule) |
| CAS_NO | 138199-71-0 |
| technique(s) | HPLC: suitable |
| InChI | 1S/2C18H20FN3O4.H2O/c2*1-10-9-26-17-14-11(16(23)12(18(24)25)8-22(10)14)7-13(19)15(17)21-5-3-20(2)4-6-21;/h2*7-8,10H,3-6,9H2,1-2H3,(H,24,25);1H2/t2*10-;/m00./s1 |
| InChI key | SUIQUYDRLGGZOL-RCWTXCDDSA-N |
| format | neat |
| Quality Level | 300 |