Bulk Discount Available!
Lutein, 1 X 5 mg (07168-5MG)
MilliporeSigma® (Sigma-Aldrich)
$2,010.35
Earn points on this purchase
| Quality Level | 100 |
| InChI | 1S/C40H56O2/c1-29(17-13-19-31(3)21-23-37-33(5)25-35(41)27-39(37,7)8)15-11-12-16-30(2)18-14-20-32(4)22-24-38-34(6)26-36(42)28-40(38,9)10/h11-25,35-37,41-42H,26-28H2,1-10H3/b12-11+,17-13+,18-14+,23-21+,24-22+,29-15+,30-16+,31-19+,32-20+/t35-,36+,37-/m0/s1 |
| form | solid |
| SMILES string | CC(=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)C[C@@H](O)CC1(C)C)\C=C\C=C(C)\C=C\[C@H]2C(C)=C[C@H](O)CC2(C)C |
| biological source | human |
| assay | ≥96.0% (HPLC) |
| color | yellow to very dark red |
| CAS_NO | 127-40-2 |
| storage temp. | −20°C |
| technique(s) | HPLC: suitable |
| form | powder |
| biological source | animal |
| grade | analytical standard |
| InChI key | KBPHJBAIARWVSC-RGZFRNHPSA-N |
| shelf life | limited shelf life, expiry date on the label |
| format | neat |
| application(s) | detectionfood and beverages |
| technique(s) | gas chromatography (GC): suitable |