Bulk Discount Available!
Mannitol, 1 X 1 g (PHR1007-1G)
MilliporeSigma® (Sigma-Aldrich)
$114.00
Earn points on this purchase
| API family | mannitol |
| technique(s) | gas chromatography (GC): suitable |
| InChI key | FBPFZTCFMRRESA-KVTDHHQDSA-N |
| technique(s) | HPLC: suitable |
| Quality Level | 300 |
| mp | 167-170 °C (lit.) |
| grade | pharmaceutical secondary standard |
| agency | traceable to Ph. Eur. M0200000 |
| analyte chemical class(es) | oligosaccharides |
| application(s) | cleaning productscosmeticsfood and beveragespersonal carepharmaceutical (small molecule) |
| SMILES string | OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| format | neat |
| CofA | current certificate can be downloaded |
| storage temp. | 2-30°C |
| CAS_NO | 69-65-8 |
| grade | certified reference material |
| InChI | 1S/C6H14O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3-12H,1-2H2/t3-,4-,5-,6-/m1/s1 |
| agency | traceable to USP 1375105 |