Bulk Discount Available!
Mefloquine Hydrochloride, 1 g (PHR1705-1G)
MilliporeSigma® (Sigma-Aldrich)
$130.76
Earn points on this purchase
| storage temp. | 2-30°C |
| technique(s) | gas chromatography (GC): suitable |
| API family | mefloquine |
| agency | traceable to USP 1379059 |
| SMILES string | Cl[H].[H][C@@]1(CCCCN1)[C@@H](O)c2cc(nc3c(cccc23)C(F)(F)F)C(F)(F)F |
| packaging | pkg of 1 g |
| grade | certified reference material |
| InChI key | WESWYMRNZNDGBX-YLCXCWDSSA-N |
| format | neat |
| CAS_NO | 51773-92-3 |
| InChI | 1S/C17H16F6N2O.ClH/c18-16(19,20)11-5-3-4-9-10(15(26)12-6-1-2-7-24-12)8-13(17(21,22)23)25-14(9)11;/h3-5,8,12,15,24,26H,1-2,6-7H2;1H/t12-,15+;/m1./s1 |
| Quality Level | 300 |
| CofA | current certificate can be downloaded |
| application(s) | pharmaceutical (small molecule) |
| grade | pharmaceutical secondary standard |
| technique(s) | HPLC: suitable |
| agency | traceable to Ph. Eur. M0253000 |